C20H28O3 — CID 69243608
2-methoxy-4-prop-2-enylphenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 69243608) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-methoxy-4-prop-2-enylphenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 2-methoxy-4-prop-2-enylphenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 69243608 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C=CCc1ccc(O)c(OC)c1.CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C10H12O2.C10H16O/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-9(2)7-4-5-10(9,3)8(11)6-7/h3,5-7,11H,1,4H2,2H3;7H,4-6H2,1-3H3 |
| InChIKey | LOBSCZRTUUKECD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|