C15H7ClF3N3O3 — CID 69243936
[4-chloro-2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 69243936) has the molecular formula C15H7ClF3N3O3 and a molecular weight of 369.69 g/mol. Its IUPAC name is [4-chloro-2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-chloro-2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69243936 |
| Molecular Formula | C15H7ClF3N3O3 |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | [4-chloro-2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(Cl)cc1-c1nnc(-c2cccnc2)o1)C(F)(F)F |
| InChI | InChI=1S/C15H7ClF3N3O3/c16-9-3-4-11(24-14(23)15(17,18)19)10(6-9)13-22-21-12(25-13)8-2-1-5-20-7-8/h1-7H |
| InChIKey | SQVSMIJDPBAPPP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|