About 5-amino-N,3-diphenyl-1H-indole-2-carboxamide
5-amino-N,3-diphenyl-1H-indole-2-carboxamide (PubChem CID 69244689) has the molecular formula C21H17N3O
and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-amino-N,3-diphenyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N,3-diphenyl-1H-indole-2-carboxamide |
| PubChem CID | 69244689 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-amino-N,3-diphenyl-1H-indole-2-carboxamide |
| SMILES | Nc1ccc2[nH]c(C(=O)Nc3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H17N3O/c22-15-11-12-18-17(13-15)19(14-7-3-1-4-8-14)20(24-18)21(25)23-16-9-5-2-6-10-16/h1-13,24H,22H2,(H,23,25) |
| InChIKey | ZDSSLRDEXWASKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N,3-diphenyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,3-diphenyl-1H-indole-2-carboxamide?
The IUPAC name of 5-amino-N,3-diphenyl-1H-indole-2-carboxamide (CID 69244689) is 5-amino-N,3-diphenyl-1H-indole-2-carboxamide.
What is the SMILES notation for 5-amino-N,3-diphenyl-1H-indole-2-carboxamide?
The canonical SMILES for 5-amino-N,3-diphenyl-1H-indole-2-carboxamide is Nc1ccc2[nH]c(C(=O)Nc3ccccc3)c(-c3ccccc3)c2c1.
What is the InChIKey of 5-amino-N,3-diphenyl-1H-indole-2-carboxamide?
The InChIKey is ZDSSLRDEXWASKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O/c22-15-11-12-18-17(13-15)19(14-7-3-1-4-8-14)20(24-18)21(25)23-16-9-5-2-6-10-16/h1-13,24H,22H2,(H,23,25).
What are the key properties of 5-amino-N,3-diphenyl-1H-indole-2-carboxamide?
5-amino-N,3-diphenyl-1H-indole-2-carboxamide has a molecular weight of 327.39 g/mol, XLogP of 4.67, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,3-diphenyl-1H-indole-2-carboxamide is sourced from PubChem (CID 69244689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).