About 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide
1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide (PubChem CID 69244855) has the molecular formula C13H19OP
and a molecular weight of 222.27 g/mol. Its IUPAC name is 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide.
Molecular Properties
| Compound Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide |
| PubChem CID | 69244855 |
| Molecular Formula | C13H19OP |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide |
| SMILES | CCC1(P2(=O)CC=C(C)C2)C=CC=CC1 |
| InChI | InChI=1S/C13H19OP/c1-3-13(8-5-4-6-9-13)15(14)10-7-12(2)11-15/h4-8H,3,9-11H2,1-2H3 |
| InChIKey | HCRICACLWJQXFI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide?
The IUPAC name of 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide (CID 69244855) is 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide.
What is the SMILES notation for 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide?
The canonical SMILES for 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide is CCC1(P2(=O)CC=C(C)C2)C=CC=CC1.
What is the InChIKey of 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide?
The InChIKey is HCRICACLWJQXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19OP/c1-3-13(8-5-4-6-9-13)15(14)10-7-12(2)11-15/h4-8H,3,9-11H2,1-2H3.
What are the key properties of 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide?
1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide has a molecular weight of 222.27 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylcyclohexa-2,4-dien-1-yl)-3-methyl-2,5-dihydro-1λ5-phosphole 1-oxide is sourced from PubChem (CID 69244855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).