About 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid
2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid (PubChem CID 69244893) has the molecular formula C18H18Br2FNO3
and a molecular weight of 475.15 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid |
| PubChem CID | 69244893 |
| Molecular Formula | C18H18Br2FNO3 |
| Molecular Weight | 475.15 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid |
| SMILES | CCNc1cc(C)cc(COc2c(Br)cc(CC(=O)O)cc2Br)c1F |
| InChI | InChI=1S/C18H18Br2FNO3/c1-3-22-15-5-10(2)4-12(17(15)21)9-25-18-13(19)6-11(7-14(18)20)8-16(23)24/h4-7,22H,3,8-9H2,1-2H3,(H,23,24) |
| InChIKey | KOKQGXDFZVGDMT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.15 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid?
The IUPAC name of 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid (CID 69244893) is 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid is CCNc1cc(C)cc(COc2c(Br)cc(CC(=O)O)cc2Br)c1F.
What is the InChIKey of 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid?
The InChIKey is KOKQGXDFZVGDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Br2FNO3/c1-3-22-15-5-10(2)4-12(17(15)21)9-25-18-13(19)6-11(7-14(18)20)8-16(23)24/h4-7,22H,3,8-9H2,1-2H3,(H,23,24).
What are the key properties of 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid?
2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid has a molecular weight of 475.15 g/mol, XLogP of 5.30, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dibromo-4-[[3-(ethylamino)-2-fluoro-5-methylphenyl]methoxy]phenyl]acetic acid is sourced from PubChem (CID 69244893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).