C25H27ClF3N7O2 — CID 69245108
[3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-1-(diethylamino)prop-2-ynyl] 2,2,2-trifluoroacetate (PubChem CID 69245108) has the molecular formula C25H27ClF3N7O2 and a molecular weight of 549.99 g/mol. Its IUPAC name is [3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-1-(diethylamino)prop-2-ynyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-1-(diethylamino)prop-2-ynyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69245108 |
| Molecular Formula | C25H27ClF3N7O2 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-1-(diethylamino)prop-2-ynyl] 2,2,2-trifluoroacetate |
| SMILES | CCN(CC)C(C#Cc1[nH]nc2ncnc(N3CCN(c4cc(Cl)ccc4C)CC3)c12)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H27ClF3N7O2/c1-4-34(5-2)20(38-24(37)25(27,28)29)9-8-18-21-22(33-32-18)30-15-31-23(21)36-12-10-35(11-13-36)19-14-17(26)7-6-16(19)3/h6-7,14-15,20H,4-5,10-13H2,1-3H3,(H,30,31,32,33) |
| InChIKey | SVXAYIMKDJTFMD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|