About 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid
2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid (PubChem CID 69246538) has the molecular formula C20H19Br2ClN2O4
and a molecular weight of 546.64 g/mol. Its IUPAC name is 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid |
| PubChem CID | 69246538 |
| Molecular Formula | C20H19Br2ClN2O4 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 543.94 |
| IUPAC Name | 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(Br)c(OCc2cccc(NCC3CC3)c2Cl)c(Br)c1 |
| InChI | InChI=1S/C20H19Br2ClN2O4/c21-14-6-13(20(28)25-9-17(26)27)7-15(22)19(14)29-10-12-2-1-3-16(18(12)23)24-8-11-4-5-11/h1-3,6-7,11,24H,4-5,8-10H2,(H,25,28)(H,26,27) |
| InChIKey | AHFGYQNJPMUYMT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid?
The IUPAC name of 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid (CID 69246538) is 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid.
What is the SMILES notation for 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid?
The canonical SMILES for 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid is O=C(O)CNC(=O)c1cc(Br)c(OCc2cccc(NCC3CC3)c2Cl)c(Br)c1.
What is the InChIKey of 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid?
The InChIKey is AHFGYQNJPMUYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Br2ClN2O4/c21-14-6-13(20(28)25-9-17(26)27)7-15(22)19(14)29-10-12-2-1-3-16(18(12)23)24-8-11-4-5-11/h1-3,6-7,11,24H,4-5,8-10H2,(H,25,28)(H,26,27).
What are the key properties of 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid?
2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid has a molecular weight of 546.64 g/mol, XLogP of 5.08, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dibromo-4-[[2-chloro-3-(cyclopropylmethylamino)phenyl]methoxy]benzoyl]amino]acetic acid is sourced from PubChem (CID 69246538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).