C9H17NO6 — CID 69247162
(5R,6S,7R,7aR)-6-aminooxy-5-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol (PubChem CID 69247162) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is (5R,6S,7R,7aR)-6-aminooxy-5-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol.
| Compound Name | (5R,6S,7R,7aR)-6-aminooxy-5-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol |
|---|---|
| PubChem CID | 69247162 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (5R,6S,7R,7aR)-6-aminooxy-5-(hydroxymethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-7-ol |
| SMILES | CC1(C)OC2O[C@H](CO)[C@@H](ON)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H17NO6/c1-9(2)14-7-5(12)6(16-10)4(3-11)13-8(7)15-9/h4-8,11-12H,3,10H2,1-2H3/t4-,5+,6-,7-,8?/m1/s1 |
| InChIKey | PJTDGFJPXSRPPX-ZTVVOAFPSA-N |
| XLogP | -1.53 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|