C21H28N4O7 — CID 69247729
5-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;2-(diethylamino)acetic acid (PubChem CID 69247729) has the molecular formula C21H28N4O7 and a molecular weight of 448.48 g/mol. Its IUPAC name is 5-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;2-(diethylamino)acetic acid.
| Compound Name | 5-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;2-(diethylamino)acetic acid |
|---|---|
| PubChem CID | 69247729 |
| Molecular Formula | C21H28N4O7 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 5-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;2-(diethylamino)acetic acid |
| SMILES | CCN(CC)CC(=O)O.Nc1ccc2c(c1)C(=O)N(C1CCC(=O)N(CCO)C1=O)C2=O |
| InChI | InChI=1S/C15H15N3O5.C6H13NO2/c16-8-1-2-9-10(7-8)14(22)18(13(9)21)11-3-4-12(20)17(5-6-19)15(11)23;1-3-7(4-2)5-6(8)9/h1-2,7,11,19H,3-6,16H2;3-5H2,1-2H3,(H,8,9) |
| InChIKey | NHPASZFNNBEJNO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|