C30H41F2NO3Si — CID 69248521
ethyl 1-benzyl-4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-5,5-difluoro-2,6-dihydropyridine-3-carboxylate (PubChem CID 69248521) has the molecular formula C30H41F2NO3Si and a molecular weight of 529.74 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-5,5-difluoro-2,6-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-5,5-difluoro-2,6-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 69248521 |
| Molecular Formula | C30H41F2NO3Si |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | ethyl 1-benzyl-4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-5,5-difluoro-2,6-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(CCCO[Si](C)(C)C(C)(C)C)cc2)C(F)(F)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C30H41F2NO3Si/c1-7-35-28(34)26-21-33(20-24-12-9-8-10-13-24)22-30(31,32)27(26)25-17-15-23(16-18-25)14-11-19-36-37(5,6)29(2,3)4/h8-10,12-13,15-18H,7,11,14,19-22H2,1-6H3 |
| InChIKey | NSRUQHNZILBTII-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|