C17H18O3 — CID 69248556
3,4,4a,4b,6a,7,8,9-octahydro-1H-naphtho[3,4-f]isochromene-5,6-dione (PubChem CID 69248556) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3,4,4a,4b,6a,7,8,9-octahydro-1H-naphtho[3,4-f]isochromene-5,6-dione.
| Compound Name | 3,4,4a,4b,6a,7,8,9-octahydro-1H-naphtho[3,4-f]isochromene-5,6-dione |
|---|---|
| PubChem CID | 69248556 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3,4,4a,4b,6a,7,8,9-octahydro-1H-naphtho[3,4-f]isochromene-5,6-dione |
| SMILES | O=C1C(=O)C2C(=CC=C3COCCC32)C2=CCCCC12 |
| InChI | InChI=1S/C17H18O3/c18-16-14-4-2-1-3-12(14)13-6-5-10-9-20-8-7-11(10)15(13)17(16)19/h3,5-6,11,14-15H,1-2,4,7-9H2 |
| InChIKey | RJHIDHWHWSYASZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|