C17H19ClF3N3O3S — CID 69248586
3-[2,2-dioxo-3-[3-(trifluoromethoxy)phenyl]-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride (PubChem CID 69248586) has the molecular formula C17H19ClF3N3O3S and a molecular weight of 437.87 g/mol. Its IUPAC name is 3-[2,2-dioxo-3-[3-(trifluoromethoxy)phenyl]-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-[2,2-dioxo-3-[3-(trifluoromethoxy)phenyl]-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69248586 |
| Molecular Formula | C17H19ClF3N3O3S |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 3-[2,2-dioxo-3-[3-(trifluoromethoxy)phenyl]-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCN1c2ccccc2N(c2cccc(OC(F)(F)F)c2)S1(=O)=O.Cl |
| InChI | InChI=1S/C17H18F3N3O3S.ClH/c1-21-10-5-11-22-15-8-2-3-9-16(15)23(27(22,24)25)13-6-4-7-14(12-13)26-17(18,19)20;/h2-4,6-9,12,21H,5,10-11H2,1H3;1H |
| InChIKey | LXQMWWNXAZHIKH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|