About 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine
1H-pyrrolo[1,2-b][1,2,5]benzotriazepine (PubChem CID 69249967) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine.
Molecular Properties
| Compound Name | 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine |
| PubChem CID | 69249967 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine |
| SMILES | C1=CC2=CN=c3ccccc3=NN2C1 |
| InChI | InChI=1S/C11H9N3/c1-2-6-11-10(5-1)12-8-9-4-3-7-14(9)13-11/h1-6,8H,7H2 |
| InChIKey | RRGDFEUFOROQFW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine?
The IUPAC name of 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine (CID 69249967) is 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine.
What is the SMILES notation for 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine?
The canonical SMILES for 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine is C1=CC2=CN=c3ccccc3=NN2C1.
What is the InChIKey of 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine?
The InChIKey is RRGDFEUFOROQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-6-11-10(5-1)12-8-9-4-3-7-14(9)13-11/h1-6,8H,7H2.
What are the key properties of 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine?
1H-pyrrolo[1,2-b][1,2,5]benzotriazepine has a molecular weight of 183.21 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[1,2-b][1,2,5]benzotriazepine is sourced from PubChem (CID 69249967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).