About 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate
1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate (PubChem CID 69250022) has the molecular formula C17H24N2O4
and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate.
Molecular Properties
| Compound Name | 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate |
| PubChem CID | 69250022 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC1CCCC1)c1cn(C2CCCC2)cn1 |
| InChI | InChI=1S/C17H24N2O4/c1-22-16(20)15(17(21)23-13-8-4-5-9-13)14-10-19(11-18-14)12-6-2-3-7-12/h10-13,15H,2-9H2,1H3 |
| InChIKey | SBDURDZSCYRTAA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate?
The IUPAC name of 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate (CID 69250022) is 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate.
What is the SMILES notation for 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate?
The canonical SMILES for 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate is COC(=O)C(C(=O)OC1CCCC1)c1cn(C2CCCC2)cn1.
What is the InChIKey of 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate?
The InChIKey is SBDURDZSCYRTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O4/c1-22-16(20)15(17(21)23-13-8-4-5-9-13)14-10-19(11-18-14)12-6-2-3-7-12/h10-13,15H,2-9H2,1H3.
What are the key properties of 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate?
1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate has a molecular weight of 320.39 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-cyclopentyl 3-O-methyl 2-(1-cyclopentylimidazol-4-yl)propanedioate is sourced from PubChem (CID 69250022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).