C13H17O4P — CID 69250269
[2-oxo-2-(1-phenylcyclopentyl)ethyl]phosphonic acid (PubChem CID 69250269) has the molecular formula C13H17O4P and a molecular weight of 268.25 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylcyclopentyl)ethyl]phosphonic acid.
| Compound Name | [2-oxo-2-(1-phenylcyclopentyl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 69250269 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [2-oxo-2-(1-phenylcyclopentyl)ethyl]phosphonic acid |
| SMILES | O=C(CP(=O)(O)O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C13H17O4P/c14-12(10-18(15,16)17)13(8-4-5-9-13)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H2,15,16,17) |
| InChIKey | MGLOEKPOXFOSDN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|