C18H28O2 — CID 69251055
[(8R,9S,10R,13R,14S)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 69251055) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14S)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(8R,9S,10R,13R,14S)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 69251055 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [(8R,9S,10R,13R,14S)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | OC(O)[C@@]12CCC[C@H]1[C@@H]1CC=C3CCCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C18H28O2/c19-17(20)18-10-3-6-16(18)15-8-7-12-4-1-2-5-13(12)14(15)9-11-18/h7,13-17,19-20H,1-6,8-11H2/t13-,14+,15+,16-,18+/m0/s1 |
| InChIKey | FIVLTMPXNRLATF-VNIVASGNSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|