C28H37N5O3 — CID 69251322
N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide (PubChem CID 69251322) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide.
| Compound Name | N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 69251322 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)CCCCCc1cc(-c2ccccn2)nn1-c1ccc(C(C)(C)C)cc1)C(N)=O |
| InChI | InChI=1S/C28H37N5O3/c1-19(34)26(27(29)36)31-25(35)12-7-5-6-10-22-18-24(23-11-8-9-17-30-23)32-33(22)21-15-13-20(14-16-21)28(2,3)4/h8-9,11,13-19,26,34H,5-7,10,12H2,1-4H3,(H2,29,36)(H,31,35)/t19-,26+/m1/s1 |
| InChIKey | BNZYXEVCLOLJGH-BCHFMIIMSA-N |
| XLogP | 3.69 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|