About (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one
(2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 6925144) has the molecular formula C12H11N3O2S
and a molecular weight of 261.31 g/mol. Its IUPAC name is (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| PubChem CID | 6925144 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(N2C(=O)CS[C@H]2c2cccnc2)no1 |
| InChI | InChI=1S/C12H11N3O2S/c1-8-5-10(14-17-8)15-11(16)7-18-12(15)9-3-2-4-13-6-9/h2-6,12H,7H2,1H3/t12-/m0/s1 |
| InChIKey | FJGNKWIWXZWLAA-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The IUPAC name of (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one (CID 6925144) is (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The canonical SMILES for (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one is Cc1cc(N2C(=O)CS[C@H]2c2cccnc2)no1.
What is the InChIKey of (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one?
The InChIKey is FJGNKWIWXZWLAA-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H11N3O2S/c1-8-5-10(14-17-8)15-11(16)7-18-12(15)9-3-2-4-13-6-9/h2-6,12H,7H2,1H3/t12-/m0/s1.
What are the key properties of (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one?
(2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one has a molecular weight of 261.31 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(5-methyl-1,2-oxazol-3-yl)-2-pyridin-3-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 6925144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).