C21H13F4N3OS — CID 69251800
4-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-8-(2,3,4-trifluorophenyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 69251800) has the molecular formula C21H13F4N3OS and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-8-(2,3,4-trifluorophenyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-8-(2,3,4-trifluorophenyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69251800 |
| Molecular Formula | C21H13F4N3OS |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 4-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-8-(2,3,4-trifluorophenyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1nc(-c2cc(F)ccc2C)c2ccc(=O)n(-c3ccc(F)c(F)c3F)c2n1 |
| InChI | InChI=1S/C21H13F4N3OS/c1-10-3-4-11(22)9-13(10)19-12-5-8-16(29)28(20(12)27-21(26-19)30-2)15-7-6-14(23)17(24)18(15)25/h3-9H,1-2H3 |
| InChIKey | AHOGIYDRMYOKON-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|