About 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine
4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine (PubChem CID 69251891) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine |
| PubChem CID | 69251891 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine |
| SMILES | COC1C=CN(C)C(C)N1C |
| InChI | InChI=1S/C8H16N2O/c1-7-9(2)6-5-8(11-4)10(7)3/h5-8H,1-4H3 |
| InChIKey | JGCQGUPZJSJCRS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine?
The IUPAC name of 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine (CID 69251891) is 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine.
What is the SMILES notation for 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine?
The canonical SMILES for 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine is COC1C=CN(C)C(C)N1C.
What is the InChIKey of 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine?
The InChIKey is JGCQGUPZJSJCRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7-9(2)6-5-8(11-4)10(7)3/h5-8H,1-4H3.
What are the key properties of 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine?
4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine has a molecular weight of 156.23 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2,3-trimethyl-2,4-dihydropyrimidine is sourced from PubChem (CID 69251891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).