C20H17Cl4NO4 — CID 69252994
2-(1-adamantyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetic acid (PubChem CID 69252994) has the molecular formula C20H17Cl4NO4 and a molecular weight of 477.17 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetic acid.
| Compound Name | 2-(1-adamantyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 69252994 |
| Molecular Formula | C20H17Cl4NO4 |
| Molecular Weight | 477.17 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 2-(1-adamantyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetic acid |
| SMILES | O=C(O)C(N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H17Cl4NO4/c21-12-10-11(13(22)15(24)14(12)23)18(27)25(17(10)26)16(19(28)29)20-4-7-1-8(5-20)3-9(2-7)6-20/h7-9,16H,1-6H2,(H,28,29) |
| InChIKey | YBLCZCICWJKUOZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.17 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|