About [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea
[6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea (PubChem CID 69253228) has the molecular formula C27H32N6O2
and a molecular weight of 472.59 g/mol. Its IUPAC name is [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea.
Molecular Properties
| Compound Name | [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
| PubChem CID | 69253228 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
| SMILES | N#Cc1ccc2cc(NC(N)=O)n(CCCCN3CCN(c4cccc5c4OCCC5)CC3)c2c1 |
| InChI | InChI=1S/C27H32N6O2/c28-19-20-8-9-22-18-25(30-27(29)34)33(24(22)17-20)11-2-1-10-31-12-14-32(15-13-31)23-7-3-5-21-6-4-16-35-26(21)23/h3,5,7-9,17-18H,1-2,4,6,10-16H2,(H3,29,30,34) |
| InChIKey | BKLHUBJRENIUDD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea?
The IUPAC name of [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea (CID 69253228) is [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea.
What is the SMILES notation for [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea?
The canonical SMILES for [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea is N#Cc1ccc2cc(NC(N)=O)n(CCCCN3CCN(c4cccc5c4OCCC5)CC3)c2c1.
What is the InChIKey of [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea?
The InChIKey is BKLHUBJRENIUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N6O2/c28-19-20-8-9-22-18-25(30-27(29)34)33(24(22)17-20)11-2-1-10-31-12-14-32(15-13-31)23-7-3-5-21-6-4-16-35-26(21)23/h3,5,7-9,17-18H,1-2,4,6,10-16H2,(H3,29,30,34).
What are the key properties of [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea?
[6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea has a molecular weight of 472.59 g/mol, XLogP of 3.93, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-cyano-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]indol-2-yl]urea is sourced from PubChem (CID 69253228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).