C28H27NO3 — CID 69253282
2-(3-phenylpentan-3-yl)-4-(quinolin-2-ylmethoxy)benzoic acid (PubChem CID 69253282) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(3-phenylpentan-3-yl)-4-(quinolin-2-ylmethoxy)benzoic acid.
| Compound Name | 2-(3-phenylpentan-3-yl)-4-(quinolin-2-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 69253282 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-(3-phenylpentan-3-yl)-4-(quinolin-2-ylmethoxy)benzoic acid |
| SMILES | CCC(CC)(c1ccccc1)c1cc(OCc2ccc3ccccc3n2)ccc1C(=O)O |
| InChI | InChI=1S/C28H27NO3/c1-3-28(4-2,21-11-6-5-7-12-21)25-18-23(16-17-24(25)27(30)31)32-19-22-15-14-20-10-8-9-13-26(20)29-22/h5-18H,3-4,19H2,1-2H3,(H,30,31) |
| InChIKey | ZOLYZYLEUKIXOC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |