C14H20O2 — CID 6925379
(5aR,9aS)-3,3-dimethyl-2,4,5a,6,7,8,9,9a-octahydrodibenzofuran-1-one (PubChem CID 6925379) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (5aR,9aS)-3,3-dimethyl-2,4,5a,6,7,8,9,9a-octahydrodibenzofuran-1-one.
| Compound Name | (5aR,9aS)-3,3-dimethyl-2,4,5a,6,7,8,9,9a-octahydrodibenzofuran-1-one |
|---|---|
| PubChem CID | 6925379 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (5aR,9aS)-3,3-dimethyl-2,4,5a,6,7,8,9,9a-octahydrodibenzofuran-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C14H20O2/c1-14(2)7-10(15)13-9-5-3-4-6-11(9)16-12(13)8-14/h9,11H,3-8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | JDJDXJJZYDSTLY-MWLCHTKSSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |