C12H25N3 — CID 69253806
N,N,1,3-tetraethyl-2,4-dihydropyrimidin-2-amine (PubChem CID 69253806) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is N,N,1,3-tetraethyl-2,4-dihydropyrimidin-2-amine.
| Compound Name | N,N,1,3-tetraethyl-2,4-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 69253806 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N,N,1,3-tetraethyl-2,4-dihydropyrimidin-2-amine |
| SMILES | CCN1C=CCN(CC)C1N(CC)CC |
| InChI | InChI=1S/C12H25N3/c1-5-13(6-2)12-14(7-3)10-9-11-15(12)8-4/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | FFRLFCGFKNFNET-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |