C23H28ClN3O4S — CID 69254267
N-[4-amino-5-(3-chlorophenyl)-2-oxo-1-pyrrolidin-2-ylpentyl]-2-methylsulfonylbenzamide (PubChem CID 69254267) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is N-[4-amino-5-(3-chlorophenyl)-2-oxo-1-pyrrolidin-2-ylpentyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[4-amino-5-(3-chlorophenyl)-2-oxo-1-pyrrolidin-2-ylpentyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 69254267 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[4-amino-5-(3-chlorophenyl)-2-oxo-1-pyrrolidin-2-ylpentyl]-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NC(C(=O)CC(N)Cc1cccc(Cl)c1)C1CCCN1 |
| InChI | InChI=1S/C23H28ClN3O4S/c1-32(30,31)21-10-3-2-8-18(21)23(29)27-22(19-9-5-11-26-19)20(28)14-17(25)13-15-6-4-7-16(24)12-15/h2-4,6-8,10,12,17,19,22,26H,5,9,11,13-14,25H2,1H3,(H,27,29) |
| InChIKey | DOCZAQHAPKUKKB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |