About 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide
4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide (PubChem CID 69254548) has the molecular formula C21H21N3O4S
and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide |
| PubChem CID | 69254548 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide |
| SMILES | Cc1cc(S(C)(=O)=O)c2ncc(C(N)=O)c(Nc3cccc4c3CCCO4)c2c1 |
| InChI | InChI=1S/C21H21N3O4S/c1-12-9-14-19(24-16-6-3-7-17-13(16)5-4-8-28-17)15(21(22)25)11-23-20(14)18(10-12)29(2,26)27/h3,6-7,9-11H,4-5,8H2,1-2H3,(H2,22,25)(H,23,24) |
| InChIKey | IVBLWCLQKIWAEB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide?
The IUPAC name of 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide (CID 69254548) is 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide.
What is the SMILES notation for 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide?
The canonical SMILES for 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide is Cc1cc(S(C)(=O)=O)c2ncc(C(N)=O)c(Nc3cccc4c3CCCO4)c2c1.
What is the InChIKey of 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide?
The InChIKey is IVBLWCLQKIWAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4S/c1-12-9-14-19(24-16-6-3-7-17-13(16)5-4-8-28-17)15(21(22)25)11-23-20(14)18(10-12)29(2,26)27/h3,6-7,9-11H,4-5,8H2,1-2H3,(H2,22,25)(H,23,24).
What are the key properties of 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide?
4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide has a molecular weight of 411.48 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-chromen-5-ylamino)-6-methyl-8-methylsulfonylquinoline-3-carboxamide is sourced from PubChem (CID 69254548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).