About (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol
(1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol (PubChem CID 69254729) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol.
Analyze (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol?
The IUPAC name of (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol (CID 69254729) is (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol.
What is the SMILES notation for (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol?
The canonical SMILES for (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol is CC1N(C)C=CC(CO)N1C.
What is the InChIKey of (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol?
The InChIKey is SKUUSKQGFXPRDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7-9(2)5-4-8(6-11)10(7)3/h4-5,7-8,11H,6H2,1-3H3.
What are the key properties of (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol?
(1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol has a molecular weight of 156.23 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2,3-trimethyl-2,4-dihydropyrimidin-4-yl)methanol is sourced from PubChem (CID 69254729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).