C54H56O6 — CID 69254949
2-[bis(4-hydroxyphenyl)methyl]-4-[3-[3-[bis(4-hydroxyphenyl)methyl]-4-hydroxy-5-propan-2-ylphenyl]-1-adamantyl]-6-propan-2-ylphenol (PubChem CID 69254949) has the molecular formula C54H56O6 and a molecular weight of 801.04 g/mol. Its IUPAC name is 2-[bis(4-hydroxyphenyl)methyl]-4-[3-[3-[bis(4-hydroxyphenyl)methyl]-4-hydroxy-5-propan-2-ylphenyl]-1-adamantyl]-6-propan-2-ylphenol.
| Compound Name | 2-[bis(4-hydroxyphenyl)methyl]-4-[3-[3-[bis(4-hydroxyphenyl)methyl]-4-hydroxy-5-propan-2-ylphenyl]-1-adamantyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 69254949 |
| Molecular Formula | C54H56O6 |
| Molecular Weight | 801.04 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | 2-[bis(4-hydroxyphenyl)methyl]-4-[3-[3-[bis(4-hydroxyphenyl)methyl]-4-hydroxy-5-propan-2-ylphenyl]-1-adamantyl]-6-propan-2-ylphenol |
| SMILES | CC(C)c1cc(C23CC4CC(C2)CC(c2cc(C(C)C)c(O)c(C(c5ccc(O)cc5)c5ccc(O)cc5)c2)(C4)C3)cc(C(c2ccc(O)cc2)c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C54H56O6/c1-31(2)45-22-39(24-47(51(45)59)49(35-5-13-41(55)14-6-35)36-7-15-42(56)16-8-36)53-26-33-21-34(27-53)29-54(28-33,30-53)40-23-46(32(3)4)52(60)48(25-40)50(37-9-17-43(57)18-10-37)38-11-19-44(58)20-12-38/h5-20,22-25,31-34,49-50,55-60H,21,26-30H2,1-4H3 |
| InChIKey | LJBUKVGHBBZQIK-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.04 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|