C8H12O4 — CID 69255207
1-(4-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)ethanone (PubChem CID 69255207) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)ethanone.
| Compound Name | 1-(4-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)ethanone |
|---|---|
| PubChem CID | 69255207 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-(4-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)ethanone |
| SMILES | CC(=O)C1OC2OCCC2C1O |
| InChI | InChI=1S/C8H12O4/c1-4(9)7-6(10)5-2-3-11-8(5)12-7/h5-8,10H,2-3H2,1H3 |
| InChIKey | BQWZRVMNGZZZMV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |