About 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one
6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one (PubChem CID 69255369) has the molecular formula C8H7FOS
and a molecular weight of 170.21 g/mol. Its IUPAC name is 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one |
| PubChem CID | 69255369 |
| Molecular Formula | C8H7FOS |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one |
| SMILES | O=C1C=C(F)C=C2SCCC12 |
| InChI | InChI=1S/C8H7FOS/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,6H,1-2H2 |
| InChIKey | OAHOVJDLQOPDNY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one?
The IUPAC name of 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one (CID 69255369) is 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one.
What is the SMILES notation for 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one?
The canonical SMILES for 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one is O=C1C=C(F)C=C2SCCC12.
What is the InChIKey of 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one?
The InChIKey is OAHOVJDLQOPDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FOS/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,6H,1-2H2.
What are the key properties of 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one?
6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one has a molecular weight of 170.21 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,3a-dihydro-2H-1-benzothiophen-4-one is sourced from PubChem (CID 69255369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).