C4H6N6O — CID 69255407
1-hydroxyimidazo[1,2-b][1,2,4]triazole-2,6-diamine (PubChem CID 69255407) has the molecular formula C4H6N6O and a molecular weight of 154.13 g/mol. Its IUPAC name is 1-hydroxyimidazo[1,2-b][1,2,4]triazole-2,6-diamine.
| Compound Name | 1-hydroxyimidazo[1,2-b][1,2,4]triazole-2,6-diamine |
|---|---|
| PubChem CID | 69255407 |
| Molecular Formula | C4H6N6O |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-hydroxyimidazo[1,2-b][1,2,4]triazole-2,6-diamine |
| SMILES | Nc1nc2ncc(N)n2n1O |
| InChI | InChI=1S/C4H6N6O/c5-2-1-7-4-8-3(6)10(11)9(2)4/h1,11H,5H2,(H2,6,7,8) |
| InChIKey | GMANFZQJNHZXAM-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|