C23H17Cl2F2N2O3PS — CID 69255860
[[4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 69255860) has the molecular formula C23H17Cl2F2N2O3PS and a molecular weight of 541.34 g/mol. Its IUPAC name is [[4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 69255860 |
| Molecular Formula | C23H17Cl2F2N2O3PS |
| Molecular Weight | 541.34 g/mol |
| Exact Mass | 540.00 |
| IUPAC Name | [[4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CN(c2ccc(Cl)c(Cl)c2)c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C23H17Cl2F2N2O3PS/c24-19-11-10-18(12-20(19)25)29(22-28-21(14-34-22)16-4-2-1-3-5-16)13-15-6-8-17(9-7-15)23(26,27)33(30,31)32/h1-12,14H,13H2,(H2,30,31,32) |
| InChIKey | IEXYAYROEBPQHH-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.34 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|