C25H16Cl2N2O5S — CID 69256188
4-[2-[3,4-dichloro-N-[(4-oxalophenyl)methyl]anilino]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 69256188) has the molecular formula C25H16Cl2N2O5S and a molecular weight of 527.39 g/mol. Its IUPAC name is 4-[2-[3,4-dichloro-N-[(4-oxalophenyl)methyl]anilino]-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-[3,4-dichloro-N-[(4-oxalophenyl)methyl]anilino]-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 69256188 |
| Molecular Formula | C25H16Cl2N2O5S |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 4-[2-[3,4-dichloro-N-[(4-oxalophenyl)methyl]anilino]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | O=C(O)C(=O)c1ccc(CN(c2ccc(Cl)c(Cl)c2)c2nc(-c3ccc(C(=O)O)cc3)cs2)cc1 |
| InChI | InChI=1S/C25H16Cl2N2O5S/c26-19-10-9-18(11-20(19)27)29(12-14-1-3-16(4-2-14)22(30)24(33)34)25-28-21(13-35-25)15-5-7-17(8-6-15)23(31)32/h1-11,13H,12H2,(H,31,32)(H,33,34) |
| InChIKey | KHTJIICEVUPTRQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|