C18H20NO4S- — CID 6925632
(3S)-3-(4-propan-2-yloxyphenyl)-3-[(2-thiophen-2-ylacetyl)amino]propanoate (PubChem CID 6925632) has the molecular formula C18H20NO4S- and a molecular weight of 346.43 g/mol. Its IUPAC name is (3S)-3-(4-propan-2-yloxyphenyl)-3-[(2-thiophen-2-ylacetyl)amino]propanoate.
| Compound Name | (3S)-3-(4-propan-2-yloxyphenyl)-3-[(2-thiophen-2-ylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 6925632 |
| Molecular Formula | C18H20NO4S- |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (3S)-3-(4-propan-2-yloxyphenyl)-3-[(2-thiophen-2-ylacetyl)amino]propanoate |
| SMILES | CC(C)Oc1ccc([C@H](CC(=O)[O-])NC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-12(2)23-14-7-5-13(6-8-14)16(11-18(21)22)19-17(20)10-15-4-3-9-24-15/h3-9,12,16H,10-11H2,1-2H3,(H,19,20)(H,21,22)/p-1/t16-/m0/s1 |
| InChIKey | BWJWWHYPCMZQSF-INIZCTEOSA-M |
| XLogP | 2.08 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |