About azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one
azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one (PubChem CID 69256439) has the molecular formula C9H18N4O
and a molecular weight of 198.27 g/mol. Its IUPAC name is azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one |
| PubChem CID | 69256439 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one |
| SMILES | C1=NCCN1.C=CN1CCCC1=O.N |
| InChI | InChI=1S/C6H9NO.C3H6N2.H3N/c1-2-7-5-3-4-6(7)8;1-2-5-3-4-1;/h2H,1,3-5H2;3H,1-2H2,(H,4,5);1H3 |
| InChIKey | JXUGSEGUPJCAHW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The IUPAC name of azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one (CID 69256439) is azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The canonical SMILES for azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one is C1=NCCN1.C=CN1CCCC1=O.N.
What is the InChIKey of azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
The InChIKey is JXUGSEGUPJCAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C3H6N2.H3N/c1-2-7-5-3-4-6(7)8;1-2-5-3-4-1;/h2H,1,3-5H2;3H,1-2H2,(H,4,5);1H3.
What are the key properties of azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one?
azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one has a molecular weight of 198.27 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4,5-dihydro-1H-imidazole;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 69256439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).