About 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline
3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline (PubChem CID 69256446) has the molecular formula C21H22FN3O2
and a molecular weight of 367.42 g/mol. Its IUPAC name is 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline.
Molecular Properties
| Compound Name | 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline |
| PubChem CID | 69256446 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline |
| SMILES | CCOC(OCC)c1nn(-c2ccc(F)cc2)c2c1CCc1cnccc1-2 |
| InChI | InChI=1S/C21H22FN3O2/c1-3-26-21(27-4-2)19-18-10-5-14-13-23-12-11-17(14)20(18)25(24-19)16-8-6-15(22)7-9-16/h6-9,11-13,21H,3-5,10H2,1-2H3 |
| InChIKey | BBVGCKGOJZTUDJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline?
The IUPAC name of 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline (CID 69256446) is 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline.
What is the SMILES notation for 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline?
The canonical SMILES for 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline is CCOC(OCC)c1nn(-c2ccc(F)cc2)c2c1CCc1cnccc1-2.
What is the InChIKey of 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline?
The InChIKey is BBVGCKGOJZTUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O2/c1-3-26-21(27-4-2)19-18-10-5-14-13-23-12-11-17(14)20(18)25(24-19)16-8-6-15(22)7-9-16/h6-9,11-13,21H,3-5,10H2,1-2H3.
What are the key properties of 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline?
3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline has a molecular weight of 367.42 g/mol, XLogP of 4.24, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethoxymethyl)-1-(4-fluorophenyl)-4,5-dihydropyrazolo[5,4-f]isoquinoline is sourced from PubChem (CID 69256446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).