About pyrrolidin-1-yl acetate;hydrochloride
pyrrolidin-1-yl acetate;hydrochloride (PubChem CID 69256605) has the molecular formula C6H12ClNO2
and a molecular weight of 165.62 g/mol. Its IUPAC name is pyrrolidin-1-yl acetate;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-1-yl acetate;hydrochloride |
| PubChem CID | 69256605 |
| Molecular Formula | C6H12ClNO2 |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | pyrrolidin-1-yl acetate;hydrochloride |
| SMILES | CC(=O)ON1CCCC1.Cl |
| InChI | InChI=1S/C6H11NO2.ClH/c1-6(8)9-7-4-2-3-5-7;/h2-5H2,1H3;1H |
| InChIKey | FGYOXQLLLCDYOR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl acetate;hydrochloride?
The IUPAC name of pyrrolidin-1-yl acetate;hydrochloride (CID 69256605) is pyrrolidin-1-yl acetate;hydrochloride.
What is the SMILES notation for pyrrolidin-1-yl acetate;hydrochloride?
The canonical SMILES for pyrrolidin-1-yl acetate;hydrochloride is CC(=O)ON1CCCC1.Cl.
What is the InChIKey of pyrrolidin-1-yl acetate;hydrochloride?
The InChIKey is FGYOXQLLLCDYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.ClH/c1-6(8)9-7-4-2-3-5-7;/h2-5H2,1H3;1H.
What are the key properties of pyrrolidin-1-yl acetate;hydrochloride?
pyrrolidin-1-yl acetate;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl acetate;hydrochloride is sourced from PubChem (CID 69256605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).