C26H20BrCl2F2N2O5PS — CID 69256730
3-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]phenyl]propanoic acid (PubChem CID 69256730) has the molecular formula C26H20BrCl2F2N2O5PS and a molecular weight of 692.30 g/mol. Its IUPAC name is 3-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69256730 |
| Molecular Formula | C26H20BrCl2F2N2O5PS |
| Molecular Weight | 692.30 g/mol |
| Exact Mass | 689.94 |
| IUPAC Name | 3-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2csc(N(Cc3ccc(C(F)(F)P(=O)(O)O)c(Br)c3)c3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C26H20BrCl2F2N2O5PS/c27-20-11-16(3-8-19(20)26(30,31)39(36,37)38)13-33(18-7-9-21(28)22(29)12-18)25-32-23(14-40-25)17-5-1-15(2-6-17)4-10-24(34)35/h1-3,5-9,11-12,14H,4,10,13H2,(H,34,35)(H2,36,37,38) |
| InChIKey | SBZFHWHJXLVBRZ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.30 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|