C11H15NO3S — CID 69256754
4-methyl-3-(pentanoylamino)thiophene-2-carboxylic acid (PubChem CID 69256754) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-methyl-3-(pentanoylamino)thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(pentanoylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69256754 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 4-methyl-3-(pentanoylamino)thiophene-2-carboxylic acid |
| SMILES | CCCCC(=O)Nc1c(C)csc1C(=O)O |
| InChI | InChI=1S/C11H15NO3S/c1-3-4-5-8(13)12-9-7(2)6-16-10(9)11(14)15/h6H,3-5H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | HLNPVNQYPNSJIA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |