C11H19NO2 — CID 6925690
2-(2,2,6,6-tetramethyl-1,3-dihydropyridin-1-ium-4-yl)acetate (PubChem CID 6925690) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethyl-1,3-dihydropyridin-1-ium-4-yl)acetate.
| Compound Name | 2-(2,2,6,6-tetramethyl-1,3-dihydropyridin-1-ium-4-yl)acetate |
|---|---|
| PubChem CID | 6925690 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(2,2,6,6-tetramethyl-1,3-dihydropyridin-1-ium-4-yl)acetate |
| SMILES | CC1(C)C=C(CC(=O)[O-])CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C11H19NO2/c1-10(2)6-8(5-9(13)14)7-11(3,4)12-10/h6,12H,5,7H2,1-4H3,(H,13,14) |
| InChIKey | SZISVVSXLCUDMM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|