C15H20N4O4 — CID 69256990
1-[3-[[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]methylamino]propyl]-1,3-diazinane-2,4-dione (PubChem CID 69256990) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[3-[[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]methylamino]propyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-[[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]methylamino]propyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 69256990 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[3-[[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]methylamino]propyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(CCCNC[C@H]2COc3cccnc3O2)C(=O)N1 |
| InChI | InChI=1S/C15H20N4O4/c20-13-4-8-19(15(21)18-13)7-2-5-16-9-11-10-22-12-3-1-6-17-14(12)23-11/h1,3,6,11,16H,2,4-5,7-10H2,(H,18,20,21)/t11-/m0/s1 |
| InChIKey | RVRYUUSBMBDQOH-NSHDSACASA-N |
| XLogP | 0.14 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|