About 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol
2-(9H-pyrido[2,3-b]indol-6-yl)ethanol (PubChem CID 69258073) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol |
| PubChem CID | 69258073 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol |
| SMILES | OCCc1ccc2[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C13H12N2O/c16-7-5-9-3-4-12-11(8-9)10-2-1-6-14-13(10)15-12/h1-4,6,8,16H,5,7H2,(H,14,15) |
| InChIKey | JTMJVUJNGMZTMV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol?
The IUPAC name of 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol (CID 69258073) is 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol.
What is the SMILES notation for 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol?
The canonical SMILES for 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol is OCCc1ccc2[nH]c3ncccc3c2c1.
What is the InChIKey of 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol?
The InChIKey is JTMJVUJNGMZTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c16-7-5-9-3-4-12-11(8-9)10-2-1-6-14-13(10)15-12/h1-4,6,8,16H,5,7H2,(H,14,15).
What are the key properties of 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol?
2-(9H-pyrido[2,3-b]indol-6-yl)ethanol has a molecular weight of 212.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9H-pyrido[2,3-b]indol-6-yl)ethanol is sourced from PubChem (CID 69258073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).