C9H18N2O2 — CID 69258159
(2S)-2-amino-N-cyclopropyl-2-hydroxyhexanamide (PubChem CID 69258159) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclopropyl-2-hydroxyhexanamide.
| Compound Name | (2S)-2-amino-N-cyclopropyl-2-hydroxyhexanamide |
|---|---|
| PubChem CID | 69258159 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2S)-2-amino-N-cyclopropyl-2-hydroxyhexanamide |
| SMILES | CCCC[C@](N)(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H18N2O2/c1-2-3-6-9(10,13)8(12)11-7-4-5-7/h7,13H,2-6,10H2,1H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | CHEMCBOMJWKMIE-VIFPVBQESA-N |
| XLogP | 0.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|