About 4-phenyl-3H-furo[3,4-c]pyridin-1-one
4-phenyl-3H-furo[3,4-c]pyridin-1-one (PubChem CID 69259082) has the molecular formula C13H9NO2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-phenyl-3H-furo[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 4-phenyl-3H-furo[3,4-c]pyridin-1-one |
| PubChem CID | 69259082 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-phenyl-3H-furo[3,4-c]pyridin-1-one |
| SMILES | O=C1OCc2c1ccnc2-c1ccccc1 |
| InChI | InChI=1S/C13H9NO2/c15-13-10-6-7-14-12(11(10)8-16-13)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | FWQTZQQJKKAMOL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-3H-furo[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3H-furo[3,4-c]pyridin-1-one?
The IUPAC name of 4-phenyl-3H-furo[3,4-c]pyridin-1-one (CID 69259082) is 4-phenyl-3H-furo[3,4-c]pyridin-1-one.
What is the SMILES notation for 4-phenyl-3H-furo[3,4-c]pyridin-1-one?
The canonical SMILES for 4-phenyl-3H-furo[3,4-c]pyridin-1-one is O=C1OCc2c1ccnc2-c1ccccc1.
What is the InChIKey of 4-phenyl-3H-furo[3,4-c]pyridin-1-one?
The InChIKey is FWQTZQQJKKAMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-13-10-6-7-14-12(11(10)8-16-13)9-4-2-1-3-5-9/h1-7H,8H2.
What are the key properties of 4-phenyl-3H-furo[3,4-c]pyridin-1-one?
4-phenyl-3H-furo[3,4-c]pyridin-1-one has a molecular weight of 211.22 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3H-furo[3,4-c]pyridin-1-one is sourced from PubChem (CID 69259082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).