C17H19ClF2N2O3S — CID 69259331
3-[(3S)-6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine;hydrochloride (PubChem CID 69259331) has the molecular formula C17H19ClF2N2O3S and a molecular weight of 404.87 g/mol. Its IUPAC name is 3-[(3S)-6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-[(3S)-6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69259331 |
| Molecular Formula | C17H19ClF2N2O3S |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[(3S)-6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-4,2λ6,1-benzoxathiazin-3-yl]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCC[C@H]1Oc2cc(F)ccc2N(c2ccccc2F)S1(=O)=O.Cl |
| InChI | InChI=1S/C17H18F2N2O3S.ClH/c1-20-10-4-7-17-24-16-11-12(18)8-9-15(16)21(25(17,22)23)14-6-3-2-5-13(14)19;/h2-3,5-6,8-9,11,17,20H,4,7,10H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | PSQHQVDFHMAXQC-LMOVPXPDSA-N |
| XLogP | 3.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|