C24H29ClN2O6 — CID 69259478
3-[3-chloro-4-[3-(2,4-dimethylpentan-3-ylcarbamoyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoic acid (PubChem CID 69259478) has the molecular formula C24H29ClN2O6 and a molecular weight of 476.96 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(2,4-dimethylpentan-3-ylcarbamoyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[3-chloro-4-[3-(2,4-dimethylpentan-3-ylcarbamoyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69259478 |
| Molecular Formula | C24H29ClN2O6 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[3-chloro-4-[3-(2,4-dimethylpentan-3-ylcarbamoyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)CC(=O)O)cc(Cl)c1Oc1cccc(C(=O)NC(C(C)C)C(C)C)c1O |
| InChI | InChI=1S/C24H29ClN2O6/c1-12(2)21(13(3)4)27-24(32)16-7-6-8-18(22(16)31)33-23-14(5)9-15(10-17(23)25)26-19(28)11-20(29)30/h6-10,12-13,21,31H,11H2,1-5H3,(H,26,28)(H,27,32)(H,29,30) |
| InChIKey | FXQSLRBGIJZZEH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|