C20H19ClFNO3S — CID 69259535
3-(3-chloropropyl)-1-(3-fluorophenyl)-2,2-dihydroxybenzo[g][4,2,1]benzoxathiazine (PubChem CID 69259535) has the molecular formula C20H19ClFNO3S and a molecular weight of 407.89 g/mol. Its IUPAC name is 3-(3-chloropropyl)-1-(3-fluorophenyl)-2,2-dihydroxybenzo[g][4,2,1]benzoxathiazine.
| Compound Name | 3-(3-chloropropyl)-1-(3-fluorophenyl)-2,2-dihydroxybenzo[g][4,2,1]benzoxathiazine |
|---|---|
| PubChem CID | 69259535 |
| Molecular Formula | C20H19ClFNO3S |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-(3-chloropropyl)-1-(3-fluorophenyl)-2,2-dihydroxybenzo[g][4,2,1]benzoxathiazine |
| SMILES | OS1(O)C(CCCCl)Oc2cc3ccccc3cc2N1c1cccc(F)c1 |
| InChI | InChI=1S/C20H19ClFNO3S/c21-10-4-9-20-26-19-12-15-6-2-1-5-14(15)11-18(19)23(27(20,24)25)17-8-3-7-16(22)13-17/h1-3,5-8,11-13,20,24-25H,4,9-10H2 |
| InChIKey | PZGFNPASTRPOQU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|