C33H25F3O2S — CID 69259562
(triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2,2-diphenylpropanoate (PubChem CID 69259562) has the molecular formula C33H25F3O2S and a molecular weight of 542.62 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2,2-diphenylpropanoate.
| Compound Name | (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2,2-diphenylpropanoate |
|---|---|
| PubChem CID | 69259562 |
| Molecular Formula | C33H25F3O2S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 3,3,3-trifluoro-2,2-diphenylpropanoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H25F3O2S/c34-33(35,36)32(26-16-6-1-7-17-26,27-18-8-2-9-19-27)31(37)38-39(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25H |
| InChIKey | SLTNFHSDGCOHBE-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |