C16H15ClFNO3S — CID 69259578
3-(3-chloropropyl)-1-(4-fluorophenyl)-4,2λ6,1-benzoxathiazine 2,2-dioxide (PubChem CID 69259578) has the molecular formula C16H15ClFNO3S and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-(3-chloropropyl)-1-(4-fluorophenyl)-4,2λ6,1-benzoxathiazine 2,2-dioxide.
| Compound Name | 3-(3-chloropropyl)-1-(4-fluorophenyl)-4,2λ6,1-benzoxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 69259578 |
| Molecular Formula | C16H15ClFNO3S |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-(3-chloropropyl)-1-(4-fluorophenyl)-4,2λ6,1-benzoxathiazine 2,2-dioxide |
| SMILES | O=S1(=O)C(CCCCl)Oc2ccccc2N1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15ClFNO3S/c17-11-3-6-16-22-15-5-2-1-4-14(15)19(23(16,20)21)13-9-7-12(18)8-10-13/h1-2,4-5,7-10,16H,3,6,11H2 |
| InChIKey | ZOHSRXQTBWCKRU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|